Byelyankacin
| Internal ID | e3e4fa05-5474-4bd2-ad53-f945d7986ea9 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > Phenolic glycosides |
| IUPAC Name | (E)-3-[4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyphenyl]prop-2-enenitrile |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2=CC=C(C=C2)C=CC#N)O)O)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2=CC=C(C=C2)/C=C/C#N)O)O)O |
| InChI | InChI=1S/C15H17NO5/c1-9-12(17)13(18)14(19)15(20-9)21-11-6-4-10(5-7-11)3-2-8-16/h2-7,9,12-15,17-19H,1H3/b3-2+ |
| InChI Key | HHRFWKLBYKKKMP-NSCUHMNNSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11067264 g/mol |
| Topological Polar Surface Area (TPSA) | 103.00 Ų |
| XlogP | 0.70 |
| (E)-3-[4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyphenyl]prop-2-enenitrile |
| (E)-3-(4-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyphenyl)prop-2-enenitrile |
| RefChem:122439 |
| 4-(2-isocyanovinyl)phenyl alpha-l-rhamnopyranoside |
| SCHEMBL30206644 |
| CHEBI:213775 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2039 | P27338 | Monoamine oxidase B | 97.53% | 92.51% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.10% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.16% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.58% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.54% | 96.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 92.15% | 95.93% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.99% | 90.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.93% | 96.09% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 87.71% | 97.36% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.33% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.68% | 94.73% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 86.37% | 94.80% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.66% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.19% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.94% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.75% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139585975 |
| LOTUS | LTS0175889 |
| wikiData | Q77496044 |