(2S,4R)-N-[(1R,2R)-2-hydroxy-1-[(2R,3R,4S,5R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide
| Internal ID | bf4a0ded-e854-41ff-a025-2286631a2fa5 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives > Proline and derivatives |
| IUPAC Name | (2S,4R)-N-[(1R,2R)-2-hydroxy-1-[(2R,3R,4S,5R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide |
| SMILES (Canonical) | CCCC1CC(N(C1)C)C(=O)NC(C2C(C(C(C(O2)SC)O)O)O)C(C)O |
| SMILES (Isomeric) | CCC[C@@H]1C[C@H](N(C1)C)C(=O)N[C@@H]([C@@H]2[C@@H]([C@@H]([C@H](C(O2)SC)O)O)O)[C@@H](C)O |
| InChI | InChI=1S/C18H34N2O6S/c1-5-6-10-7-11(20(3)8-10)17(25)19-12(9(2)21)16-14(23)13(22)15(24)18(26-16)27-4/h9-16,18,21-24H,5-8H2,1-4H3,(H,19,25)/t9-,10-,11+,12-,13+,14-,15-,16-,18?/m1/s1 |
| InChI Key | OJMMVQQUTAEWLP-RLXLMRCASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H34N2O6S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.21375798 g/mol |
| Topological Polar Surface Area (TPSA) | 148.00 Ų |
| XlogP | 0.20 |
| There are no found synonyms. |
![2D Structure of (2S,4R)-N-[(1R,2R)-2-hydroxy-1-[(2R,3R,4S,5R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide](https://plantaedb.com/storage/docs/compounds/2023/11/b8d37400-85a5-11ee-bd7b-055284865066.jpg "2D Structure of (2S,4R)-N-[(1R,2R)-2-hydroxy-1-[(2R,3R,4S,5R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-1-methyl-4-propylpyrrolidine-2-carboxamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL1293235 | P02545 | Prelamin-A/C |
63.1 nM |
Potency |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.40% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 97.59% | 97.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.23% | 98.95% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.87% | 90.17% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 94.24% | 97.21% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 94.05% | 95.58% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 93.51% | 92.12% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 93.20% | 93.56% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 92.49% | 98.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 92.42% | 90.71% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 92.39% | 94.66% |
| CHEMBL332 | P03956 | Matrix metalloproteinase-1 | 91.05% | 94.50% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.70% | 89.63% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 90.50% | 95.17% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 90.44% | 97.50% |
| CHEMBL240 | Q12809 | HERG | 89.97% | 89.76% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 89.90% | 94.45% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 89.77% | 95.71% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 89.54% | 92.86% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 89.32% | 92.29% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.01% | 83.82% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.52% | 96.95% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 88.48% | 98.05% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.44% | 96.47% |
| CHEMBL4073 | P09237 | Matrix metalloproteinase 7 | 88.22% | 97.56% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 87.61% | 97.14% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.56% | 95.89% |
| CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 87.47% | 98.46% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.31% | 99.17% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.08% | 100.00% |
| CHEMBL274 | P51681 | C-C chemokine receptor type 5 | 86.67% | 98.77% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 86.55% | 89.50% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 85.95% | 89.34% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.88% | 96.61% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.86% | 90.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.28% | 100.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 85.12% | 98.59% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.12% | 96.38% |
| CHEMBL2007625 | O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | 83.10% | 99.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.07% | 92.50% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 82.98% | 96.31% |
| CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 82.38% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.29% | 97.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.95% | 91.19% |
| CHEMBL283 | P08254 | Matrix metalloproteinase 3 | 80.55% | 97.29% |
| CHEMBL1075317 | P61964 | WD repeat-containing protein 5 | 80.02% | 96.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 137628482 |
| LOTUS | LTS0084096 |
| wikiData | Q105193155 |