Anhydro-5alpha-cyprinol
| Internal ID | a3f4538d-196c-4fc0-97c6-94d7545efa9f |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Cholestane steroids > Cholesterols and derivatives |
| IUPAC Name | 10,13-dimethyl-17-[5-(oxetan-3-yl)pentan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-3,7,12-triol |
| SMILES (Canonical) | CC(CCCC1COC1)C2CCC3C2(C(CC4C3C(CC5C4(CCC(C5)O)C)O)O)C |
| SMILES (Isomeric) | CC(CCCC1COC1)C2CCC3C2(C(CC4C3C(CC5C4(CCC(C5)O)C)O)O)C |
| InChI | InChI=1S/C27H46O4/c1-16(5-4-6-17-14-31-15-17)20-7-8-21-25-22(13-24(30)27(20,21)3)26(2)10-9-19(28)11-18(26)12-23(25)29/h16-25,28-30H,4-15H2,1-3H3 |
| InChI Key | UHVWHYLAKWRVGN-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C27H46O4 |
| Molecular Weight | 434.70 g/mol |
| Exact Mass | 434.33960994 g/mol |
| Topological Polar Surface Area (TPSA) | 69.90 Ų |
| XlogP | 5.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 98.64% | 85.31% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 98.53% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.24% | 96.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 95.89% | 95.93% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 95.71% | 98.10% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 93.94% | 95.58% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.77% | 97.09% |
| CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 92.52% | 89.05% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.28% | 91.11% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 92.25% | 94.45% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 91.39% | 95.92% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.16% | 95.89% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 89.45% | 98.35% |
| CHEMBL236 | P41143 | Delta opioid receptor | 89.32% | 99.35% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.01% | 100.00% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 87.81% | 95.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.69% | 94.45% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.57% | 90.08% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.49% | 98.95% |
| CHEMBL233 | P35372 | Mu opioid receptor | 87.25% | 97.93% |
| CHEMBL238 | Q01959 | Dopamine transporter | 85.77% | 95.88% |
| CHEMBL2842 | P42345 | Serine/threonine-protein kinase mTOR | 85.69% | 92.78% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.50% | 90.71% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 85.30% | 92.86% |
| CHEMBL3837 | P07711 | Cathepsin L | 85.17% | 96.61% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.90% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.68% | 97.29% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 84.58% | 97.86% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 83.62% | 96.03% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 83.60% | 98.05% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.44% | 93.56% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 82.91% | 95.34% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.91% | 95.89% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.03% | 96.43% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 81.70% | 100.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.47% | 100.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 81.21% | 99.18% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 80.31% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 53463359 |
| LOTUS | LTS0125574 |
| wikiData | Q105273122 |