L-alpha-Glutamyl-L-aspartic acid
| Internal ID | 98f19dbd-1b42-42d3-ba3c-3bbd7cfae9f6 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Hybrid peptides |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]butanedioic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C9H14N2O7/c10-4(1-2-6(12)13)8(16)11-5(9(17)18)3-7(14)15/h4-5H,1-3,10H2,(H,11,16)(H,12,13)(H,14,15)(H,17,18)/t4-,5-/m0/s1 |
| InChI Key | FYYSIASRLDJUNP-WHFBIAKZSA-N |
| Popularity | 18 references in papers |
| Molecular Formula | C9H14N2O7 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.08010079 g/mol |
| Topological Polar Surface Area (TPSA) | 167.00 Ų |
| XlogP | -4.60 |
| alpha-Glutamylaspartic acid |
| alpha-Glu-asp |
| (2S)-2-[[(2S)-2-amino-4-carboxybutanoyl]amino]butanedioic acid |
| (2S)-2-(((2S)-2-amino-4-carboxybutanoyl)amino)butanedioic acid |
| L-alpha-Glutamyl-L-aspartic acid |
| RefChem:924386 |
| H-GLU-ASP-OH |
| Glu-Asp-OH |
| Glu-Asp |
| glutamylaspartic acid |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.90% | 83.82% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.41% | 90.17% |
| CHEMBL236 | P41143 | Delta opioid receptor | 95.19% | 99.35% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 94.72% | 90.20% |
| CHEMBL3776 | Q14790 | Caspase-8 | 94.65% | 97.06% |
| CHEMBL2334 | P42574 | Caspase-3 | 94.45% | 98.25% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.12% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.60% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.19% | 99.17% |
| CHEMBL4801 | P29466 | Caspase-1 | 91.14% | 96.85% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 90.94% | 92.29% |
| CHEMBL3468 | P55210 | Caspase-7 | 90.12% | 95.68% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.89% | 93.56% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.77% | 100.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 88.76% | 97.21% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 87.78% | 96.03% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 85.97% | 100.00% |
| CHEMBL3784 | Q09472 | Histone acetyltransferase p300 | 85.85% | 93.33% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.29% | 91.19% |
| CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 83.89% | 92.26% |
| CHEMBL3308 | P55212 | Caspase-6 | 83.71% | 97.56% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 83.69% | 98.33% |
| CHEMBL3629 | P68400 | Casein kinase II alpha | 83.68% | 98.89% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.28% | 96.95% |
| CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 81.42% | 97.86% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.89% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.40% | 94.45% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 80.07% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 99716 |
| LOTUS | LTS0092632 |
| wikiData | Q27140582 |