Acinetodin
| Internal ID | 267bc1c8-4730-4a03-b713-fdee1330018b |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
| IUPAC Name | 4-[[2-[[2-[[2-[[2-[[6-(4-aminobutyl)-20-benzyl-23-butan-2-yl-2,5,8,11,14,19,22,25-octaoxo-1,4,7,10,13,18,21,24-octazabicyclo[24.3.0]nonacosane-17-carbonyl]amino]-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxybutanoyl]amino]-5-[[2-[[4-amino-1-[[1-[[1-(carboxymethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-1,4-dioxobutan-2-yl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CCC(C)C1C(=O)NC(C(=O)NC(CCC(=O)NCC(=O)NCC(=O)NC(C(=O)NCC(=O)N2CCCC2C(=O)N1)CCCCN)C(=O)NC(C(C)O)C(=O)NC(CC3=CNC4=CC=CC=C43)C(=O)NC(C(C)C)C(=O)NC(C(C)O)C(=O)NC(CCC(=O)O)C(=O)NCC(=O)NC(CC(=O)N)C(=O)NC(CC5=CC=C(C=C5)O)C(=O)NC(CC6=CC=C(C=C6)O)C(=O)NCC(=O)O)CC7=CC=CC=C7 |
| SMILES (Isomeric) | CCC(C)C1C(=O)NC(C(=O)NC(CCC(=O)NCC(=O)NCC(=O)NC(C(=O)NCC(=O)N2CCCC2C(=O)N1)CCCCN)C(=O)NC(C(C)O)C(=O)NC(CC3=CNC4=CC=CC=C43)C(=O)NC(C(C)C)C(=O)NC(C(C)O)C(=O)NC(CCC(=O)O)C(=O)NCC(=O)NC(CC(=O)N)C(=O)NC(CC5=CC=C(C=C5)O)C(=O)NC(CC6=CC=C(C=C6)O)C(=O)NCC(=O)O)CC7=CC=CC=C7 |
| InChI | InChI=1S/C92H125N21O27/c1-7-48(4)77-90(138)107-64(36-51-16-9-8-10-17-51)84(132)103-61(30-32-69(119)96-42-70(120)97-43-71(121)101-59(20-13-14-34-93)80(128)99-45-73(123)113-35-15-21-67(113)88(136)110-77)83(131)111-78(49(5)114)92(140)108-65(39-54-41-95-58-19-12-11-18-57(54)58)87(135)109-76(47(2)3)89(137)112-79(50(6)115)91(139)104-60(31-33-74(124)125)81(129)98-44-72(122)102-66(40-68(94)118)86(134)106-63(38-53-24-28-56(117)29-25-53)85(133)105-62(82(130)100-46-75(126)127)37-52-22-26-55(116)27-23-52/h8-12,16-19,22-29,41,47-50,59-67,76-79,95,114-117H,7,13-15,20-21,30-40,42-46,93H2,1-6H3,(H2,94,118)(H,96,119)(H,97,120)(H,98,129)(H,99,128)(H,100,130)(H,101,121)(H,102,122)(H,103,132)(H,104,139)(H,105,133)(H,106,134)(H,107,138)(H,108,140)(H,109,135)(H,110,136)(H,111,131)(H,112,137)(H,124,125)(H,126,127) |
| InChI Key | FZIYBBAIZQGTHJ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C92H125N21O27 |
| Molecular Weight | 1957.10 g/mol |
| Exact Mass | 1955.9053778 g/mol |
| Topological Polar Surface Area (TPSA) | 755.00 Ų |
| XlogP | -4.50 |
| Atomic LogP (AlogP) | -6.55 |
| H-Bond Acceptor | 26 |
| H-Bond Donor | 26 |
| Rotatable Bonds | 43 |
| RefChem:109260 |
| 4-((2-((2-((2-((2-(((20-(4-aminobutyl)-6-benzyl-3-(butan-2-yl)-1,4,7,12,15,18,21-heptahydroxy-24-oxo-3H,6H,9H,10H,11H,14H,17H,20H,23H,24H,26H,27H,28H,28ah-pyrrolo(2,1-i)1,4,7,10,13,16,19,22-octaazacyclohexacosan-9-yl)(hydroxy)methylidene)amino)-1,3-dihydroxybutylidene)amino)-1-hydroxy-3-(1H-indol-3-yl)propylidene)amino)-1-hydroxy-3-methylbutylidene)amino)-1,3-dihydroxybutylidene)amino)-4-((((1-((1-((1-((carboxymethyl)-C-hydroxycarbonimidoyl)-2-(4-hydroxyphenyl)ethyl)-C-hydroxycarbonimidoyl)-2-(4-hydroxyphenyl)ethyl)-C-hydroxycarbonimidoyl)-2-(C-hydroxycarbonimidoyl)ethyl)-C-hydroxycarbonimidoyl)methyl)-C-hydroxycarbonimidoyl)butanoate |
| 4-((2-((2-((2-((2-(((6-(4-aminobutyl)-20-benzyl-23-butan-2-yl-5,8,11,14,19,22,25-heptahydroxy-2-oxo-1,4,7,10,13,18,21,24-octazabicyclo(24.3.0)nonacosa-4,7,10,13,18,21,24-heptaen-17-yl)-hydroxymethylidene)amino)-1,3-dihydroxybutylidene)amino)-1-hydroxy-3-(1H-indol-3-yl)propylidene)amino)-1-hydroxy-3-methylbutylidene)amino)-1,3-dihydroxybutylidene)amino)-5-(2-(1-(1-(1-(carboxymethylimino)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl)imino-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl)imino-1,4-dihydroxy-4-iminobutan-2-yl)imino-2-hydroxyethyl)imino-5-hydroxypentanoic acid |
| 4-((2-((2-((2-((2-((6-(4-aminobutyl)-20-benzyl-23-butan-2-yl-2,5,8,11,14,19,22,25-octaoxo-1,4,7,10,13,18,21,24-octazabicyclo(24.3.0)nonacosane-17-carbonyl)amino)-3-hydroxybutanoyl)amino)-3-(1H-indol-3-yl)propanoyl)amino)-3-methylbutanoyl)amino)-3-hydroxybutanoyl)amino)-5-((2-((4-amino-1-((1-((1-(carboxymethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl)amino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl)amino)-1,4-dioxobutan-2-yl)amino)-2-oxoethyl)amino)-5-oxopentanoic acid |
| 4-[[2-[[2-[[2-[[2-[[[6-(4-aminobutyl)-20-benzyl-23-butan-2-yl-5,8,11,14,19,22,25-heptahydroxy-2-oxo-1,4,7,10,13,18,21,24-octazabicyclo[24.3.0]nonacosa-4,7,10,13,18,21,24-heptaen-17-yl]-hydroxymethylidene]amino]-1,3-dihydroxybutylidene]amino]-1-hydroxy-3-(1H-indol-3-yl)propylidene]amino]-1-hydroxy-3-methylbutylidene]amino]-1,3-dihydroxybutylidene]amino]-5-[2-[1-[1-[1-(carboxymethylimino)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]imino-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]imino-1,4-dihydroxy-4-iminobutan-2-yl]imino-2-hydroxyethyl]imino-5-hydroxypentanoic acid |
| 4-[[2-[[2-[[2-[[2-[[6-(4-aminobutyl)-20-benzyl-23-butan-2-yl-2,5,8,11,14,19,22,25-octaoxo-1,4,7,10,13,18,21,24-octazabicyclo[24.3.0]nonacosane-17-carbonyl]amino]-3-hydroxybutanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxybutanoyl]amino]-5-[[2-[[4-amino-1-[[1-[[1-(carboxymethylamino)-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-1,4-dioxobutan-2-yl]amino]-2-oxoethyl]amino]-5-oxopentanoic acid |
| 4-{[2-({2-[(2-{[2-({[20-(4-aminobutyl)-6-benzyl-3-(butan-2-yl)-1,4,7,12,15,18,21-heptahydroxy-24-oxo-3H,6H,9H,10H,11H,14H,17H,20H,23H,24H,26H,27H,28H,28ah-pyrrolo[2,1-i]1,4,7,10,13,16,19,22-octaazacyclohexacosan-9-yl](hydroxy)methylidene}amino)-1,3-dihydroxybutylidene]amino}-1-hydroxy-3-(1H-indol-3-yl)propylidene)amino]-1-hydroxy-3-methylbutylidene}amino)-1,3-dihydroxybutylidene]amino}-4-({[(1-{[1-({1-[(carboxymethyl)-C-hydroxycarbonimidoyl]-2-(4-hydroxyphenyl)ethyl}-C-hydroxycarbonimidoyl)-2-(4-hydroxyphenyl)ethyl]-C-hydroxycarbonimidoyl}-2-(C-hydroxycarbonimidoyl)ethyl)-C-hydroxycarbonimidoyl]methyl}-C-hydroxycarbonimidoyl)butanoate |
| SCHEMBL29726409 |
| CHEBI:219018 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9018 | 90.18% |
| Caco-2 | - | 0.8606 | 86.06% |
| Blood Brain Barrier | - | 0.9750 | 97.50% |
| Human oral bioavailability | - | 0.6000 | 60.00% |
| Subcellular localzation | Mitochondria | 0.4501 | 45.01% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8184 | 81.84% |
| OATP1B3 inhibitior | + | 0.9351 | 93.51% |
| MATE1 inhibitior | - | 0.8409 | 84.09% |
| OCT2 inhibitior | - | 0.8000 | 80.00% |
| BSEP inhibitior | + | 0.9646 | 96.46% |
| P-glycoprotein inhibitior | + | 0.7417 | 74.17% |
| P-glycoprotein substrate | + | 0.8872 | 88.72% |
| CYP3A4 substrate | + | 0.7626 | 76.26% |
| CYP2C9 substrate | - | 0.7932 | 79.32% |
| CYP2D6 substrate | - | 0.7871 | 78.71% |
| CYP3A4 inhibition | - | 0.7791 | 77.91% |
| CYP2C9 inhibition | - | 0.8702 | 87.02% |
| CYP2C19 inhibition | - | 0.8518 | 85.18% |
| CYP2D6 inhibition | - | 0.8903 | 89.03% |
| CYP1A2 inhibition | - | 0.9010 | 90.10% |
| CYP2C8 inhibition | + | 0.8373 | 83.73% |
| CYP inhibitory promiscuity | - | 0.7482 | 74.82% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.8900 | 89.00% |
| Carcinogenicity (trinary) | Non-required | 0.5879 | 58.79% |
| Eye corrosion | - | 0.9899 | 98.99% |
| Eye irritation | - | 0.8953 | 89.53% |
| Skin irritation | - | 0.7995 | 79.95% |
| Skin corrosion | - | 0.9365 | 93.65% |
| Ames mutagenesis | - | 0.7300 | 73.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7281 | 72.81% |
| Micronuclear | + | 0.8400 | 84.00% |
| Hepatotoxicity | - | 0.7090 | 70.90% |
| skin sensitisation | - | 0.8965 | 89.65% |
| Respiratory toxicity | + | 0.8889 | 88.89% |
| Reproductive toxicity | + | 0.9444 | 94.44% |
| Mitochondrial toxicity | + | 0.9000 | 90.00% |
| Nephrotoxicity | - | 0.7174 | 71.74% |
| Acute Oral Toxicity (c) | III | 0.5043 | 50.43% |
| Estrogen receptor binding | - | 0.5559 | 55.59% |
| Androgen receptor binding | + | 0.7177 | 71.77% |
| Thyroid receptor binding | + | 0.8140 | 81.40% |
| Glucocorticoid receptor binding | + | 0.8419 | 84.19% |
| Aromatase binding | + | 0.8199 | 81.99% |
| PPAR gamma | + | 0.7737 | 77.37% |
| Honey bee toxicity | - | 0.6316 | 63.16% |
| Biodegradation | - | 0.8750 | 87.50% |
| Crustacea aquatic toxicity | - | 0.6000 | 60.00% |
| Fish aquatic toxicity | + | 0.8735 | 87.35% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 100.00% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.88% | 91.11% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.39% | 97.64% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.26% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.94% | 94.45% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 98.93% | 82.38% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 98.89% | 90.08% |
| CHEMBL4018 | P49146 | Neuropeptide Y receptor type 2 | 98.70% | 98.94% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 98.52% | 96.67% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.25% | 85.14% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 98.04% | 94.66% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 97.74% | 90.20% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 97.14% | 88.56% |
| CHEMBL1914 | P06276 | Butyrylcholinesterase | 97.03% | 95.00% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 96.69% | 97.23% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.50% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.00% | 97.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 95.95% | 98.75% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 95.67% | 91.71% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 95.54% | 95.62% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.48% | 99.17% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 95.36% | 97.14% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.20% | 90.17% |
| CHEMBL4071 | P08311 | Cathepsin G | 95.15% | 94.64% |
| CHEMBL3176 | O43603 | Galanin receptor 2 | 94.70% | 98.89% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 94.36% | 95.89% |
| CHEMBL236 | P41143 | Delta opioid receptor | 94.21% | 99.35% |
| CHEMBL1293287 | P14735 | Insulin-degrading enzyme | 93.67% | 88.10% |
| CHEMBL1801 | P00747 | Plasminogen | 93.27% | 92.44% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 92.30% | 96.31% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 91.75% | 95.38% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.43% | 83.82% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.25% | 96.90% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 91.19% | 93.10% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 90.64% | 100.00% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 90.62% | 94.45% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 90.35% | 100.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 90.33% | 98.33% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.86% | 95.50% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.70% | 100.00% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 88.65% | 95.00% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 88.59% | 96.28% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.44% | 95.50% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 88.33% | 98.05% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.03% | 96.47% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 87.91% | 92.67% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 87.89% | 96.11% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 87.81% | 91.81% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 87.65% | 95.56% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 87.48% | 89.50% |
| CHEMBL3837 | P07711 | Cathepsin L | 87.09% | 96.61% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.89% | 94.75% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 86.87% | 88.42% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.77% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.72% | 99.15% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 86.43% | 90.24% |
| CHEMBL3202 | P48147 | Prolyl endopeptidase | 86.21% | 90.65% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 86.11% | 89.33% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 85.68% | 93.00% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 85.59% | 93.18% |
| CHEMBL206 | P03372 | Estrogen receptor alpha | 85.09% | 97.64% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 85.07% | 96.67% |
| CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 84.88% | 90.71% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.58% | 95.83% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 84.11% | 82.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 84.04% | 90.00% |
| CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.91% | 99.18% |
| CHEMBL4393 | P39900 | Matrix metalloproteinase 12 | 82.55% | 92.22% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.49% | 98.59% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.64% | 95.89% |
| CHEMBL3729 | P22748 | Carbonic anhydrase IV | 81.49% | 99.23% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 80.75% | 82.86% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.60% | 91.19% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.51% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146684526 |
| LOTUS | LTS0164979 |
| wikiData | Q105004966 |