5-[(3S,5R,8R,9S,10S,11R,13R,16S,17S)-3,11,16-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one
| Internal ID | c88cceac-93b3-4990-8248-a770e37e5481 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones |
| IUPAC Name | 5-[(3S,5R,8R,9S,10S,11R,13R,16S,17S)-3,11,16-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
| SMILES (Canonical) | CC12CCC(CC1CCC3C2C(CC4(C3=CC(C4C5=COC(=O)C=C5)O)C)O)O |
| SMILES (Isomeric) | C[C@]12CC[C@@H](C[C@H]1CC[C@@H]3[C@@H]2[C@@H](C[C@]4(C3=C[C@@H]([C@@H]4C5=COC(=O)C=C5)O)C)O)O |
| InChI | InChI=1S/C24H32O5/c1-23-8-7-15(25)9-14(23)4-5-16-17-10-18(26)21(13-3-6-20(28)29-12-13)24(17,2)11-19(27)22(16)23/h3,6,10,12,14-16,18-19,21-22,25-27H,4-5,7-9,11H2,1-2H3/t14-,15+,16+,18+,19-,21+,22-,23+,24+/m1/s1 |
| InChI Key | QWIZXLUOMFHCEL-FTCYBQLOSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.22497412 g/mol |
| Topological Polar Surface Area (TPSA) | 87.00 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.05% | 97.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.90% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.11% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.45% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.19% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.03% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.94% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.82% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.74% | 99.23% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 82.21% | 85.11% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 81.96% | 96.38% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.74% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163091145 |
| LOTUS | LTS0126114 |
| wikiData | Q105229214 |