(2R)-3-[(E)-2-[(1R,4aS,4bS,8aS,10aS)-4b,8,8,10a-tetramethyl-2-methylidene-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-1-yl]ethenyl]-2-hydroxy-2H-furan-5-one
| Internal ID | 0bbae76d-045a-4754-a3c4-655e042fd036 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesterterpenoids > Cheilanthane sesterterpenoids |
| IUPAC Name | (2R)-3-[(E)-2-[(1R,4aS,4bS,8aS,10aS)-4b,8,8,10a-tetramethyl-2-methylidene-1,3,4,4a,5,6,7,8a,9,10-decahydrophenanthren-1-yl]ethenyl]-2-hydroxy-2H-furan-5-one |
| SMILES (Canonical) | CC1(CCCC2(C1CCC3(C2CCC(=C)C3C=CC4=CC(=O)OC4O)C)C)C |
| SMILES (Isomeric) | C[C@]12CCCC([C@@H]1CC[C@]3([C@H]2CCC(=C)[C@H]3/C=C/C4=CC(=O)O[C@H]4O)C)(C)C |
| InChI | InChI=1S/C25H36O3/c1-16-7-10-20-24(4,18(16)9-8-17-15-21(26)28-22(17)27)14-11-19-23(2,3)12-6-13-25(19,20)5/h8-9,15,18-20,22,27H,1,6-7,10-14H2,2-5H3/b9-8+/t18-,19+,20-,22-,24-,25+/m1/s1 |
| InChI Key | YFUNKUDHWJXNSX-VGQHLVOFSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.26644501 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 6.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.74% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.65% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.48% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.26% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.90% | 94.75% |
| CHEMBL1977 | P11473 | Vitamin D receptor | 88.04% | 99.43% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.43% | 98.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.29% | 95.89% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.62% | 89.00% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 85.10% | 97.05% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.44% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.22% | 99.23% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.66% | 96.43% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 82.29% | 95.92% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.79% | 93.40% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.27% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163036305 |
| LOTUS | LTS0221402 |
| wikiData | Q105347804 |