(4R)-5-[[(2S,3R)-4-amino-1-[[(3S,6S,9R,15S,18R,21S,24S,30S,31R)-18-(4-aminobutyl)-9-(2-amino-2-oxoethyl)-3-[(2S)-butan-2-yl]-6-(2-carboxyethyl)-15-[(R)-carboxy(methoxy)methyl]-21-(carboxymethyl)-24,28,31-trimethyl-2,5,8,11,14,17,20,23,26,29-decaoxo-1-oxa-4,7,10,13,16,19,22,25,28-nonazacyclohentriacont-30-yl]amino]-3-hydroxy-1,4-dioxobutan-2-yl]amino]-4-[[(2S)-3-(1H-indol-3-yl)-2-(8-methyldecanoylamino)propanoyl]amino]-5-oxopentanoic acid
| Internal ID | 1d13db1f-9039-4dc3-b4ea-d66850690fb7 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | (4R)-5-[[(2S,3R)-4-amino-1-[[(3S,6S,9R,15S,18R,21S,24S,30S,31R)-18-(4-aminobutyl)-9-(2-amino-2-oxoethyl)-3-[(2S)-butan-2-yl]-6-(2-carboxyethyl)-15-[(R)-carboxy(methoxy)methyl]-21-(carboxymethyl)-24,28,31-trimethyl-2,5,8,11,14,17,20,23,26,29-decaoxo-1-oxa-4,7,10,13,16,19,22,25,28-nonazacyclohentriacont-30-yl]amino]-3-hydroxy-1,4-dioxobutan-2-yl]amino]-4-[[(2S)-3-(1H-indol-3-yl)-2-(8-methyldecanoylamino)propanoyl]amino]-5-oxopentanoic acid |
| SMILES (Canonical) | CCC(C)CCCCCCC(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NC(CCC(=O)O)C(=O)NC(C(C(=O)N)O)C(=O)NC3C(OC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CN(C3=O)C)C)CC(=O)O)CCCCN)C(C(=O)O)OC)CC(=O)N)CCC(=O)O)C(C)CC)C |
| SMILES (Isomeric) | CC[C@H](C)[C@H]1C(=O)O[C@@H]([C@@H](C(=O)N(CC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@@H](C(=O)N[C@H](C(=O)N1)CCC(=O)O)CC(=O)N)[C@H](C(=O)O)OC)CCCCN)CC(=O)O)C)C)NC(=O)[C@H]([C@H](C(=O)N)O)NC(=O)[C@@H](CCC(=O)O)NC(=O)[C@H](CC2=CNC3=CC=CC=C32)NC(=O)CCCCCCC(C)CC)C |
| InChI | InChI=1S/C73H111N17O27/c1-9-35(3)19-13-11-12-14-23-49(92)80-45(29-39-32-77-41-21-16-15-20-40(39)41)66(107)83-44(25-27-53(97)98)65(106)88-57(59(101)61(76)102)70(111)87-56-38(6)117-73(115)55(36(4)10-2)86-64(105)43(24-26-52(95)96)84-67(108)46(30-48(75)91)81-50(93)33-78-69(110)58(60(116-8)72(113)114)89-63(104)42(22-17-18-28-74)82-68(109)47(31-54(99)100)85-62(103)37(5)79-51(94)34-90(7)71(56)112/h15-16,20-21,32,35-38,42-47,55-60,77,101H,9-14,17-19,22-31,33-34,74H2,1-8H3,(H2,75,91)(H2,76,102)(H,78,110)(H,79,94)(H,80,92)(H,81,93)(H,82,109)(H,83,107)(H,84,108)(H,85,103)(H,86,105)(H,87,111)(H,88,106)(H,89,104)(H,95,96)(H,97,98)(H,99,100)(H,113,114)/t35?,36-,37-,38+,42+,43-,44+,45-,46+,47-,55-,56-,57-,58-,59+,60+/m0/s1 |
| InChI Key | VUWZKXRXFYKBQS-JWVPKTLISA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C73H111N17O27 |
| Molecular Weight | 1658.80 g/mol |
| Exact Mass | 1657.78353133 g/mol |
| Topological Polar Surface Area (TPSA) | 703.00 Ų |
| XlogP | -4.90 |
| RefChem:108383 |
| (4R)-4-(((1S,2R)-1-(((3S,6S,9R,15S,18R,21S,24S,30S,31R)-18-(4-aminobutyl)-3-((2S)-butan-2-yl)-15-((R)-carboxy(methoxy)methyl)-6-(2-carboxyethyl)-21-(carboxymethyl)-5,8,11,14,17,20,23,26-octahydroxy-9-((C-hydroxycarbonimidoyl)methyl)-24,28,31-trimethyl-2,29-dioxo-1-oxa-4,7,10,13,16,19,22,25,28-nonaazacyclohentriaconta-4,7,10,13,16,19,22,25-octaen-30-yl)-C-hydroxycarbonimidoyl)-2-hydroxy-2-(C-hydroxycarbonimidoyl)ethyl)-C-hydroxycarbonimidoyl)-4-(((2S)-1-hydroxy-2-((1-hydroxy-8-methyldecylidene)amino)-3-(1H-indol-3-yl)propylidene)amino)butanoate |
| (4R)-4-{[(1S,2R)-1-{[(3S,6S,9R,15S,18R,21S,24S,30S,31R)-18-(4-aminobutyl)-3-[(2S)-butan-2-yl]-15-[(R)-carboxy(methoxy)methyl]-6-(2-carboxyethyl)-21-(carboxymethyl)-5,8,11,14,17,20,23,26-octahydroxy-9-[(C-hydroxycarbonimidoyl)methyl]-24,28,31-trimethyl-2,29-dioxo-1-oxa-4,7,10,13,16,19,22,25,28-nonaazacyclohentriaconta-4,7,10,13,16,19,22,25-octaen-30-yl]-C-hydroxycarbonimidoyl}-2-hydroxy-2-(C-hydroxycarbonimidoyl)ethyl]-C-hydroxycarbonimidoyl}-4-{[(2S)-1-hydroxy-2-[(1-hydroxy-8-methyldecylidene)amino]-3-(1H-indol-3-yl)propylidene]amino}butanoate |
| CHEBI:220154 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.85% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.80% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.72% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.33% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.61% | 85.14% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.20% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.65% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 95.32% | 90.20% |
| CHEMBL2492 | P36544 | Neuronal acetylcholine receptor protein alpha-7 subunit | 94.74% | 88.42% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 94.65% | 97.64% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 94.15% | 96.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.10% | 94.45% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 93.65% | 93.10% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 93.65% | 98.05% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 93.53% | 97.14% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 92.92% | 91.81% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 92.12% | 93.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.87% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.49% | 99.23% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.21% | 96.90% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 91.07% | 94.75% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 91.05% | 95.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 90.97% | 98.33% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 90.93% | 92.32% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 90.80% | 82.38% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 89.66% | 90.08% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 89.58% | 89.50% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 89.47% | 96.47% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 88.27% | 95.56% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 88.16% | 83.82% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.00% | 86.33% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.83% | 93.99% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 87.80% | 96.25% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 87.75% | 89.62% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.08% | 95.89% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 86.17% | 88.56% |
| CHEMBL1949 | P62937 | Cyclophilin A | 84.57% | 98.57% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 84.05% | 93.18% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 83.97% | 97.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.30% | 98.75% |
| CHEMBL4816 | Q9Y243 | Serine/threonine-protein kinase AKT3 | 82.98% | 96.28% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 82.76% | 97.23% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.27% | 100.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 82.27% | 95.17% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.06% | 95.50% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 81.82% | 98.59% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.74% | 96.00% |
| CHEMBL4071 | P08311 | Cathepsin G | 81.65% | 94.64% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 81.03% | 85.83% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.73% | 100.00% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 80.66% | 94.66% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.34% | 89.00% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 80.29% | 95.38% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 132521890 |
| LOTUS | LTS0079596 |
| wikiData | Q105297494 |