2-[(2S,4E)-4-[(2E,4E,6E,8E,10E,12E,14E,16E)-11,17-dichloro-1-hydroxyoctadeca-2,4,6,8,10,12,14,16-octaenylidene]-1-[(2R,3R,4S,5R)-3-[(2S,3S,4S,5R)-3,4-dihydroxy-5-[(2S,3S,4R,5R)-4-hydroxy-3-methoxy-5-methyloxolan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl]-3,5-dioxopyrrolidin-2-yl]acetamide
| Internal ID | 688d2aea-9a3a-419b-88bb-65238abbac4b |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
| IUPAC Name | 2-[(2S,4E)-4-[(2E,4E,6E,8E,10E,12E,14E,16E)-11,17-dichloro-1-hydroxyoctadeca-2,4,6,8,10,12,14,16-octaenylidene]-1-[(2R,3R,4S,5R)-3-[(2S,3S,4S,5R)-3,4-dihydroxy-5-[(2S,3S,4R,5R)-4-hydroxy-3-methoxy-5-methyloxolan-2-yl]oxyoxan-2-yl]oxy-4,5-dihydroxyoxan-2-yl]-3,5-dioxopyrrolidin-2-yl]acetamide |
| SMILES (Canonical) | CC1C(C(C(O1)OC2COC(C(C2O)O)OC3C(C(COC3N4C(C(=O)C(=C(C=CC=CC=CC=CC=C(C=CC=CC=C(C)Cl)Cl)O)C4=O)CC(=O)N)O)O)OC)O |
| SMILES (Isomeric) | C[C@@H]1[C@H]([C@@H]([C@@H](O1)O[C@@H]2CO[C@H]([C@H]([C@@H]2O)O)O[C@@H]3[C@H]([C@@H](CO[C@H]3N4[C@H](C(=O)/C(=C(/C=C/C=C/C=C/C=C/C=C(\C=C\C=C\C=C(/C)\Cl)/Cl)\O)/C4=O)CC(=O)N)O)O)OC)O |
| InChI | InChI=1S/C40H50Cl2N2O15/c1-21(41)14-10-9-12-16-23(42)15-11-7-5-4-6-8-13-17-25(45)29-31(49)24(18-28(43)47)44(37(29)53)38-35(32(50)26(46)19-55-38)59-39-34(52)33(51)27(20-56-39)58-40-36(54-3)30(48)22(2)57-40/h4-17,22,24,26-27,30,32-36,38-40,45-46,48,50-52H,18-20H2,1-3H3,(H2,43,47)/b5-4+,8-6+,10-9+,11-7+,16-12+,17-13+,21-14+,23-15+,29-25+/t22-,24+,26-,27-,30-,32+,33-,34+,35-,36+,38-,39+,40+/m1/s1 |
| InChI Key | PLUSNOWKJZSMMW-TXNACTMLSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C40H50Cl2N2O15 |
| Molecular Weight | 869.70 g/mol |
| Exact Mass | 868.2588243 g/mol |
| Topological Polar Surface Area (TPSA) | 257.00 Ų |
| XlogP | 1.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.62% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.00% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 97.82% | 83.82% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.13% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.26% | 94.45% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.40% | 91.19% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.94% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.40% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.78% | 95.56% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.55% | 93.00% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.35% | 90.17% |
| CHEMBL1974 | P36888 | Tyrosine-protein kinase receptor FLT3 | 84.81% | 91.83% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.73% | 95.89% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.53% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.63% | 90.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 81.52% | 97.36% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 81.50% | 96.77% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 81.02% | 97.33% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.74% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 100975901 |
| LOTUS | LTS0092971 |
| wikiData | Q105211246 |