[(1R,5S,7S,9S,10R,11R,12R,13S,14R,15R,16S,17S,22S,23S,24R,25S)-10,13,14-triacetyloxy-3,22-dihydroxy-11,15,17,22,23-pentamethyl-4,21-dioxo-8,20-dioxaheptacyclo[13.10.0.02,12.05,11.07,9.016,24.019,23]pentacosa-2,18-dien-25-yl] acetate
| Internal ID | f808c144-3c6d-441f-975e-f23d563211a1 |
| Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Withanolides and derivatives |
| IUPAC Name | [(1R,5S,7S,9S,10R,11R,12R,13S,14R,15R,16S,17S,22S,23S,24R,25S)-10,13,14-triacetyloxy-3,22-dihydroxy-11,15,17,22,23-pentamethyl-4,21-dioxo-8,20-dioxaheptacyclo[13.10.0.02,12.05,11.07,9.016,24.019,23]pentacosa-2,18-dien-25-yl] acetate |
| SMILES (Canonical) | CC1C=C2C(C3C1C4(C(C3OC(=O)C)C5=C(C(=O)C6CC7C(O7)C(C6(C5C(C4OC(=O)C)OC(=O)C)C)OC(=O)C)O)C)(C(C(=O)O2)(C)O)C |
| SMILES (Isomeric) | C[C@@H]1C=C2[C@@]([C@H]3[C@H]1[C@@]4([C@@H]([C@H]3OC(=O)C)C5=C(C(=O)[C@H]6C[C@H]7[C@H](O7)[C@@H]([C@@]6([C@H]5[C@@H]([C@@H]4OC(=O)C)OC(=O)C)C)OC(=O)C)O)C)([C@](C(=O)O2)(C)O)C |
| InChI | InChI=1S/C36H44O14/c1-12-10-19-35(8,36(9,44)32(43)50-19)24-21(12)34(7)22(28(24)45-13(2)37)20-23(29(46-14(3)38)31(34)48-16(5)40)33(6)17(25(41)26(20)42)11-18-27(49-18)30(33)47-15(4)39/h10,12,17-18,21-24,27-31,42,44H,11H2,1-9H3/t12-,17-,18+,21+,22-,23-,24+,27+,28-,29+,30+,31+,33+,34-,35+,36-/m1/s1 |
| InChI Key | QREUCQIXJGQKSM-BOMVVGLDSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C36H44O14 |
| Molecular Weight | 700.70 g/mol |
| Exact Mass | 700.27310607 g/mol |
| Topological Polar Surface Area (TPSA) | 202.00 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.00% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.38% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.47% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.06% | 83.82% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.98% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.10% | 98.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 90.06% | 91.19% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.95% | 97.25% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.87% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.76% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.97% | 89.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.94% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.44% | 97.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.43% | 85.14% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.23% | 100.00% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 83.87% | 92.51% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.33% | 92.50% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.22% | 90.00% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 83.16% | 94.42% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.56% | 94.73% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.53% | 85.00% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.25% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Tacca plantaginea |
| PubChem | 56925337 |
| LOTUS | LTS0033828 |
| wikiData | Q105226255 |