[2-[[2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-3-yl]oxy]-3,5-dihydroxy-6-methyloxan-4-yl] 3-phenylprop-2-enoate
| Internal ID | 114c8ae9-9072-4d1e-ab3d-64519ec0189e |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
| IUPAC Name | [2-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-2,3-dihydrochromen-3-yl]oxy]-3,5-dihydroxy-6-methyloxan-4-yl] 3-phenylprop-2-enoate |
| SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)O)OC(=O)C=CC5=CC=CC=C5)O |
| SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)O)OC(=O)C=CC5=CC=CC=C5)O |
| InChI | InChI=1S/C30H28O12/c1-14-24(36)28(41-22(35)10-7-15-5-3-2-4-6-15)26(38)30(39-14)42-29-25(37)23-20(34)12-17(31)13-21(23)40-27(29)16-8-9-18(32)19(33)11-16/h2-14,24,26-34,36,38H,1H3 |
| InChI Key | NYPYCPQTNYBOTK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H28O12 |
| Molecular Weight | 580.50 g/mol |
| Exact Mass | 580.15807632 g/mol |
| Topological Polar Surface Area (TPSA) | 192.00 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.78% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 99.15% | 91.49% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.97% | 86.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.37% | 95.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.67% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.34% | 99.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.89% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.36% | 98.95% |
| CHEMBL3194 | P02766 | Transthyretin | 91.31% | 90.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.01% | 96.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.89% | 94.73% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.57% | 99.15% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 86.54% | 83.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.28% | 90.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.15% | 99.17% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 80.66% | 80.78% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 80.24% | 97.53% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Andira inermis |
| PubChem | 73880699 |
| LOTUS | LTS0068197 |
| wikiData | Q105187623 |