N-[2-butan-2-yl-5-[(3-chloro-4-methoxyphenyl)methyl]-15-[3-(diaminomethylideneamino)propyl]-21-hydroxy-4,11-dimethyl-3,6,9,13,16,22-hexaoxo-8-propan-2-yl-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]-2,3-dihydroxypropanamide
| Internal ID | 880e2676-eede-43dc-a5de-e2f212585c29 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | N-[2-butan-2-yl-5-[(3-chloro-4-methoxyphenyl)methyl]-15-[3-(diaminomethylideneamino)propyl]-21-hydroxy-4,11-dimethyl-3,6,9,13,16,22-hexaoxo-8-propan-2-yl-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]-2,3-dihydroxypropanamide |
| SMILES (Canonical) | CCC(C)C1C(=O)N(C(C(=O)NC(C(=O)OC(C(C(=O)NC(C(=O)NC2CCC(N1C2=O)O)CCCN=C(N)N)NC(=O)C(CO)O)C)C(C)C)CC3=CC(=C(C=C3)OC)Cl)C |
| SMILES (Isomeric) | CCC(C)C1C(=O)N(C(C(=O)NC(C(=O)OC(C(C(=O)NC(C(=O)NC2CCC(N1C2=O)O)CCCN=C(N)N)NC(=O)C(CO)O)C)C(C)C)CC3=CC(=C(C=C3)OC)Cl)C |
| InChI | InChI=1S/C40H62ClN9O12/c1-8-20(4)32-38(59)49(6)26(17-22-11-13-28(61-7)23(41)16-22)34(55)47-30(19(2)3)39(60)62-21(5)31(48-35(56)27(52)18-51)36(57)45-24(10-9-15-44-40(42)43)33(54)46-25-12-14-29(53)50(32)37(25)58/h11,13,16,19-21,24-27,29-32,51-53H,8-10,12,14-15,17-18H2,1-7H3,(H,45,57)(H,46,54)(H,47,55)(H,48,56)(H4,42,43,44) |
| InChI Key | FSJIJAPZQVZIBD-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C40H62ClN9O12 |
| Molecular Weight | 896.40 g/mol |
| Exact Mass | 895.4206461 g/mol |
| Topological Polar Surface Area (TPSA) | 318.00 Ų |
| XlogP | 0.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.84% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.81% | 83.82% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.65% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.37% | 98.95% |
| CHEMBL3837 | P07711 | Cathepsin L | 98.57% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.78% | 91.11% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 96.62% | 95.89% |
| CHEMBL4072 | P07858 | Cathepsin B | 96.54% | 93.67% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.50% | 99.17% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 93.54% | 92.88% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.32% | 86.33% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 92.48% | 93.03% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 91.31% | 86.92% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.16% | 95.56% |
| CHEMBL1949 | P62937 | Cyclophilin A | 90.96% | 98.57% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 90.88% | 89.50% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 90.63% | 97.14% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 89.43% | 96.38% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.34% | 97.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 89.27% | 96.00% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 88.84% | 96.90% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.12% | 90.71% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 87.77% | 97.50% |
| CHEMBL2096618 | P11274 | Bcr/Abl fusion protein | 87.77% | 85.83% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.73% | 95.89% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.66% | 93.00% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 87.51% | 92.29% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 87.39% | 98.59% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 87.11% | 94.66% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.51% | 97.25% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.97% | 90.00% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 85.04% | 91.24% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.03% | 96.21% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.14% | 91.19% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 83.12% | 100.00% |
| CHEMBL2000 | P03952 | Plasma kallikrein | 82.26% | 93.92% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 82.21% | 94.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 82.20% | 95.50% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.77% | 90.24% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 81.30% | 92.32% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.64% | 94.00% |
| CHEMBL5314 | Q06418 | Tyrosine-protein kinase receptor TYRO3 | 80.53% | 96.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.51% | 95.93% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 80.13% | 80.71% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.02% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 74976188 |
| LOTUS | LTS0159871 |
| wikiData | Q104166735 |