2-[28-[Carboxy(hydroxy)methyl]-9-[3-(diaminomethylideneamino)propyl]-13,32-dihydroxy-21-(1-hydroxyethyl)-3-(hydroxymethyl)-18-methyl-25-(10-methylundecyl)-2,5,8,11,17,20,23,27,30-nonaoxo-26-oxa-1,4,7,10,16,19,22,29-octazatricyclo[29.3.0.012,16]tetratriacontan-6-yl]-2-hydroxyacetic acid
| Internal ID | d4bd36c0-8dcd-4097-930c-129d97cb0cc4 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | 2-[28-[carboxy(hydroxy)methyl]-9-[3-(diaminomethylideneamino)propyl]-13,32-dihydroxy-21-(1-hydroxyethyl)-3-(hydroxymethyl)-18-methyl-25-(10-methylundecyl)-2,5,8,11,17,20,23,27,30-nonaoxo-26-oxa-1,4,7,10,16,19,22,29-octazatricyclo[29.3.0.012,16]tetratriacontan-6-yl]-2-hydroxyacetic acid |
| SMILES (Canonical) | CC1C(=O)N2CCC(C2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N3CCC(C3C(=O)NC(C(=O)OC(CC(=O)NC(C(=O)N1)C(C)O)CCCCCCCCCC(C)C)C(C(=O)O)O)O)CO)C(C(=O)O)O)CCCN=C(N)N)O |
| SMILES (Isomeric) | CC1C(=O)N2CCC(C2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N3CCC(C3C(=O)NC(C(=O)OC(CC(=O)NC(C(=O)N1)C(C)O)CCCCCCCCCC(C)C)C(C(=O)O)O)O)CO)C(C(=O)O)O)CCCN=C(N)N)O |
| InChI | InChI=1S/C49H81N11O20/c1-23(2)13-10-8-6-5-7-9-11-14-26-21-31(65)56-32(25(4)62)40(69)53-24(3)44(73)59-19-16-29(63)35(59)42(71)54-27(15-12-18-52-49(50)51)39(68)57-33(37(66)46(75)76)41(70)55-28(22-61)45(74)60-20-17-30(64)36(60)43(72)58-34(48(79)80-26)38(67)47(77)78/h23-30,32-38,61-64,66-67H,5-22H2,1-4H3,(H,53,69)(H,54,71)(H,55,70)(H,56,65)(H,57,68)(H,58,72)(H,75,76)(H,77,78)(H4,50,51,52) |
| InChI Key | KDBXJRLNARFRRV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C49H81N11O20 |
| Molecular Weight | 1144.20 g/mol |
| Exact Mass | 1143.56593402 g/mol |
| Topological Polar Surface Area (TPSA) | 502.00 Ų |
| XlogP | -1.10 |
| Atomic LogP (AlogP) | -6.36 |
| H-Bond Acceptor | 19 |
| H-Bond Donor | 16 |
| Rotatable Bonds | 20 |
| There are no found synonyms. |
![2D Structure of 2-[28-[Carboxy(hydroxy)methyl]-9-[3-(diaminomethylideneamino)propyl]-13,32-dihydroxy-21-(1-hydroxyethyl)-3-(hydroxymethyl)-18-methyl-25-(10-methylundecyl)-2,5,8,11,17,20,23,27,30-nonaoxo-26-oxa-1,4,7,10,16,19,22,29-octazatricyclo[29.3.0.012,16]tetratriacontan-6-yl]-2-hydroxyacetic acid](https://plantaedb.com/storage/docs/compounds/2023/11/3f5f6c40-8771-11ee-94eb-317cc4d03981.jpg "2D Structure of 2-[28-[Carboxy(hydroxy)methyl]-9-[3-(diaminomethylideneamino)propyl]-13,32-dihydroxy-21-(1-hydroxyethyl)-3-(hydroxymethyl)-18-methyl-25-(10-methylundecyl)-2,5,8,11,17,20,23,27,30-nonaoxo-26-oxa-1,4,7,10,16,19,22,29-octazatricyclo[29.3.0.012,16]tetratriacontan-6-yl]-2-hydroxyacetic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | - | 0.5187 | 51.87% |
| Caco-2 | - | 0.8586 | 85.86% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.6429 | 64.29% |
| Subcellular localzation | Lysosomes | 0.6074 | 60.74% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8373 | 83.73% |
| OATP1B3 inhibitior | + | 0.9319 | 93.19% |
| MATE1 inhibitior | - | 0.8000 | 80.00% |
| OCT2 inhibitior | - | 0.7000 | 70.00% |
| BSEP inhibitior | + | 0.8991 | 89.91% |
| P-glycoprotein inhibitior | + | 0.7423 | 74.23% |
| P-glycoprotein substrate | + | 0.8710 | 87.10% |
| CYP3A4 substrate | + | 0.7121 | 71.21% |
| CYP2C9 substrate | - | 0.6038 | 60.38% |
| CYP2D6 substrate | - | 0.8413 | 84.13% |
| CYP3A4 inhibition | - | 0.9486 | 94.86% |
| CYP2C9 inhibition | - | 0.8977 | 89.77% |
| CYP2C19 inhibition | - | 0.8772 | 87.72% |
| CYP2D6 inhibition | - | 0.9151 | 91.51% |
| CYP1A2 inhibition | - | 0.9027 | 90.27% |
| CYP2C8 inhibition | + | 0.5724 | 57.24% |
| CYP inhibitory promiscuity | - | 0.9951 | 99.51% |
| UGT catelyzed | + | 0.6000 | 60.00% |
| Carcinogenicity (binary) | - | 0.9100 | 91.00% |
| Carcinogenicity (trinary) | Non-required | 0.5610 | 56.10% |
| Eye corrosion | - | 0.9836 | 98.36% |
| Eye irritation | - | 0.8973 | 89.73% |
| Skin irritation | - | 0.7586 | 75.86% |
| Skin corrosion | - | 0.9164 | 91.64% |
| Ames mutagenesis | - | 0.6300 | 63.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3608 | 36.08% |
| Micronuclear | + | 0.8300 | 83.00% |
| Hepatotoxicity | + | 0.5625 | 56.25% |
| skin sensitisation | - | 0.8354 | 83.54% |
| Respiratory toxicity | + | 0.7444 | 74.44% |
| Reproductive toxicity | + | 0.8667 | 86.67% |
| Mitochondrial toxicity | + | 0.8500 | 85.00% |
| Nephrotoxicity | + | 0.6696 | 66.96% |
| Acute Oral Toxicity (c) | III | 0.5862 | 58.62% |
| Estrogen receptor binding | + | 0.7430 | 74.30% |
| Androgen receptor binding | + | 0.7198 | 71.98% |
| Thyroid receptor binding | + | 0.5886 | 58.86% |
| Glucocorticoid receptor binding | + | 0.6501 | 65.01% |
| Aromatase binding | + | 0.6723 | 67.23% |
| PPAR gamma | + | 0.7542 | 75.42% |
| Honey bee toxicity | - | 0.7856 | 78.56% |
| Biodegradation | - | 0.7000 | 70.00% |
| Crustacea aquatic toxicity | - | 0.6569 | 65.69% |
| Fish aquatic toxicity | - | 0.5819 | 58.19% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.78% | 83.82% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.43% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 99.33% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.46% | 91.11% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 95.58% | 90.71% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.46% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.12% | 97.09% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 91.87% | 100.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.77% | 85.14% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 91.63% | 93.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.45% | 93.56% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 91.44% | 90.08% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.09% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.95% | 95.56% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 89.68% | 95.92% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 89.54% | 97.64% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.17% | 95.89% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 88.95% | 94.66% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.80% | 96.47% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 88.07% | 93.18% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 87.95% | 98.03% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.13% | 95.50% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.24% | 92.88% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 86.19% | 97.05% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 86.02% | 96.11% |
| CHEMBL3837 | P07711 | Cathepsin L | 85.80% | 96.61% |
| CHEMBL2443 | P49862 | Kallikrein 7 | 83.73% | 94.00% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 83.21% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.72% | 100.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.28% | 86.33% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 81.88% | 95.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.83% | 96.00% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 81.79% | 88.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.78% | 99.23% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.11% | 96.90% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.07% | 89.00% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 80.96% | 98.33% |
| CHEMBL1949 | P62937 | Cyclophilin A | 80.60% | 98.57% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.55% | 97.14% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 80.11% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 85131944 |
| LOTUS | LTS0162985 |
| wikiData | Q77570224 |