3-Methoxy-5-methylnaphthalene-1-carboxamide
| Internal ID | fcae30c8-aeb7-4176-aad4-b16c7f4be655 |
| Taxonomy | Benzenoids > Naphthalenes > Naphthalenecarboxylic acids and derivatives > Naphthalenecarboxamides |
| IUPAC Name | 3-methoxy-5-methylnaphthalene-1-carboxamide |
| SMILES (Canonical) | CC1=C2C=C(C=C(C2=CC=C1)C(=O)N)OC |
| SMILES (Isomeric) | CC1=C2C=C(C=C(C2=CC=C1)C(=O)N)OC |
| InChI | InChI=1S/C13H13NO2/c1-8-4-3-5-10-11(8)6-9(16-2)7-12(10)13(14)15/h3-7H,1-2H3,(H2,14,15) |
| InChI Key | IHDCPWKTOXBFID-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.094628657 g/mol |
| Topological Polar Surface Area (TPSA) | 52.30 Ų |
| XlogP | 2.40 |
| 22250-89-1 |
| 3-Methoxy-5-methyl-1-naphthamide |
| DTXSID70550481 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.70% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.55% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.00% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 92.11% | 98.75% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 88.34% | 93.65% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.95% | 86.33% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 87.12% | 93.31% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.95% | 95.50% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.74% | 99.15% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.73% | 98.95% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 83.95% | 100.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.55% | 94.00% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.50% | 97.36% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.43% | 96.00% |
| CHEMBL240 | Q12809 | HERG | 82.05% | 89.76% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.91% | 94.73% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.64% | 94.45% |
| CHEMBL3085 | P43003 | Excitatory amino acid transporter 1 | 81.29% | 94.67% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.96% | 90.00% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.39% | 95.89% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.02% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 13818743 |
| LOTUS | LTS0098349 |
| wikiData | Q82429865 |