3-Heptadec-1-enylphenol
| Internal ID | b4f547bf-efee-4fb0-839c-a968787f84bf |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Styrenes |
| IUPAC Name | 3-heptadec-1-enylphenol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C23H38O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-22-19-17-20-23(24)21-22/h16-21,24H,2-15H2,1H3 |
| InChI Key | MZXSKLSWTRMINA-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.292265831 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 10.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL240 | Q12809 | HERG | 97.94% | 89.76% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.71% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.39% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.95% | 91.11% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 96.93% | 92.08% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.81% | 86.33% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 93.72% | 91.71% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.10% | 91.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.16% | 94.73% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 91.92% | 96.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.73% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.28% | 95.56% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.49% | 96.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 88.46% | 93.31% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 87.51% | 89.63% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 86.09% | 97.21% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 85.13% | 93.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.38% | 93.99% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 80.61% | 97.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Schistochila appendiculata |
| PubChem | 129709918 |
| LOTUS | LTS0019305 |
| wikiData | Q105176107 |