Ac-DL-Tyr-DL-Pro-DL-Gln-DL-xiThr(1)-DL-Leu-DL-Lys(2)-DL-Tyr-DL-Pro-DL-Ser-DL-Asp(1)-DL-Trp-DL-Glu(OMe)-DL-Glu(2)-DL-Tyr-OH
| Internal ID | 8060f05d-0b49-4f6f-8bba-1f5342e133d1 |
| Taxonomy | Organic Polymers > Polypeptides |
| IUPAC Name | 2-[[38-[[2-[[1-[2-acetamido-3-(4-hydroxyphenyl)propanoyl]pyrrolidine-2-carbonyl]amino]-5-amino-5-oxopentanoyl]amino]-31-(hydroxymethyl)-22-[(4-hydroxyphenyl)methyl]-4-(1H-indol-3-ylmethyl)-7-(3-methoxy-3-oxopropyl)-37-methyl-41-(2-methylpropyl)-2,5,8,13,20,23,29,32,35,39,42-undecaoxo-36-oxa-3,6,9,14,21,24,30,33,40,43-decazatricyclo[17.14.10.024,28]tritetracontane-10-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES (Canonical) | CC1C(C(=O)NC(C(=O)NC2CCCCNC(=O)CCC(NC(=O)C(NC(=O)C(NC(=O)C(CC(=O)O1)NC(=O)C(NC(=O)C3CCCN3C(=O)C(NC2=O)CC4=CC=C(C=C4)O)CO)CC5=CNC6=CC=CC=C65)CCC(=O)OC)C(=O)NC(CC7=CC=C(C=C7)O)C(=O)O)CC(C)C)NC(=O)C(CCC(=O)N)NC(=O)C8CCCN8C(=O)C(CC9=CC=C(C=C9)O)NC(=O)C |
| SMILES (Isomeric) | CC1C(C(=O)NC(C(=O)NC2CCCCNC(=O)CCC(NC(=O)C(NC(=O)C(NC(=O)C(CC(=O)O1)NC(=O)C(NC(=O)C3CCCN3C(=O)C(NC2=O)CC4=CC=C(C=C4)O)CO)CC5=CNC6=CC=CC=C65)CCC(=O)OC)C(=O)NC(CC7=CC=C(C=C7)O)C(=O)O)CC(C)C)NC(=O)C(CCC(=O)N)NC(=O)C8CCCN8C(=O)C(CC9=CC=C(C=C9)O)NC(=O)C |
| InChI | InChI=1S/C89H115N17O26/c1-46(2)38-62-80(120)94-58-14-8-9-35-91-72(113)33-30-60(78(118)102-67(89(129)130)41-51-21-27-55(111)28-22-51)95-77(117)61(31-34-73(114)131-5)96-81(121)63(42-52-44-92-57-13-7-6-12-56(52)57)98-82(122)64(99-83(123)68(45-107)103-85(125)70-16-11-37-106(70)88(128)66(101-76(58)116)40-50-19-25-54(110)26-20-50)43-74(115)132-47(3)75(86(126)100-62)104-79(119)59(29-32-71(90)112)97-84(124)69-15-10-36-105(69)87(127)65(93-48(4)108)39-49-17-23-53(109)24-18-49/h6-7,12-13,17-28,44,46-47,58-70,75,92,107,109-111H,8-11,14-16,29-43,45H2,1-5H3,(H2,90,112)(H,91,113)(H,93,108)(H,94,120)(H,95,117)(H,96,121)(H,97,124)(H,98,122)(H,99,123)(H,100,126)(H,101,116)(H,102,118)(H,103,125)(H,104,119)(H,129,130) |
| InChI Key | UGNBQCBVWHMOCX-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C89H115N17O26 |
| Molecular Weight | 1839.00 g/mol |
| Exact Mass | 1837.81991684 g/mol |
| Topological Polar Surface Area (TPSA) | 649.00 Ų |
| XlogP | 0.80 |
| Atomic LogP (AlogP) | -2.87 |
| H-Bond Acceptor | 25 |
| H-Bond Donor | 20 |
| Rotatable Bonds | 26 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.6881 | 68.81% |
| Caco-2 | - | 0.8630 | 86.30% |
| Blood Brain Barrier | - | 1.0000 | 100.00% |
| Human oral bioavailability | - | 0.7000 | 70.00% |
| Subcellular localzation | Lysosomes | 0.4357 | 43.57% |
| OATP2B1 inhibitior | - | 1.0000 | 100.00% |
| OATP1B1 inhibitior | + | 0.8043 | 80.43% |
| OATP1B3 inhibitior | + | 0.9251 | 92.51% |
| MATE1 inhibitior | - | 0.7609 | 76.09% |
| OCT2 inhibitior | - | 0.8000 | 80.00% |
| BSEP inhibitior | + | 0.9680 | 96.80% |
| P-glycoprotein inhibitior | + | 0.7419 | 74.19% |
| P-glycoprotein substrate | + | 0.8717 | 87.17% |
| CYP3A4 substrate | + | 0.7660 | 76.60% |
| CYP2C9 substrate | - | 0.7946 | 79.46% |
| CYP2D6 substrate | - | 0.8495 | 84.95% |
| CYP3A4 inhibition | + | 0.5144 | 51.44% |
| CYP2C9 inhibition | - | 0.8196 | 81.96% |
| CYP2C19 inhibition | - | 0.8208 | 82.08% |
| CYP2D6 inhibition | - | 0.8690 | 86.90% |
| CYP1A2 inhibition | - | 0.9518 | 95.18% |
| CYP2C8 inhibition | + | 0.8490 | 84.90% |
| CYP inhibitory promiscuity | - | 0.7316 | 73.16% |
| UGT catelyzed | + | 0.8000 | 80.00% |
| Carcinogenicity (binary) | - | 0.8700 | 87.00% |
| Carcinogenicity (trinary) | Non-required | 0.5909 | 59.09% |
| Eye corrosion | - | 0.9881 | 98.81% |
| Eye irritation | - | 0.8954 | 89.54% |
| Skin irritation | - | 0.7848 | 78.48% |
| Skin corrosion | - | 0.9346 | 93.46% |
| Ames mutagenesis | - | 0.6400 | 64.00% |
| Human Ether-a-go-go-Related Gene inhibition | + | 0.7173 | 71.73% |
| Micronuclear | + | 0.8400 | 84.00% |
| Hepatotoxicity | - | 0.5076 | 50.76% |
| skin sensitisation | - | 0.8914 | 89.14% |
| Respiratory toxicity | + | 0.8111 | 81.11% |
| Reproductive toxicity | + | 0.9889 | 98.89% |
| Mitochondrial toxicity | + | 0.9125 | 91.25% |
| Nephrotoxicity | - | 0.5665 | 56.65% |
| Acute Oral Toxicity (c) | III | 0.5535 | 55.35% |
| Estrogen receptor binding | - | 0.5294 | 52.94% |
| Androgen receptor binding | + | 0.7018 | 70.18% |
| Thyroid receptor binding | + | 0.8078 | 80.78% |
| Glucocorticoid receptor binding | + | 0.8415 | 84.15% |
| Aromatase binding | + | 0.8207 | 82.07% |
| PPAR gamma | + | 0.7690 | 76.90% |
| Honey bee toxicity | - | 0.6040 | 60.40% |
| Biodegradation | - | 0.8500 | 85.00% |
| Crustacea aquatic toxicity | - | 0.5800 | 58.00% |
| Fish aquatic toxicity | + | 0.8938 | 89.38% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.98% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.89% | 91.11% |
| CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 99.41% | 97.64% |
| CHEMBL3837 | P07711 | Cathepsin L | 99.39% | 96.61% |
| CHEMBL259 | P32245 | Melanocortin receptor 4 | 98.90% | 95.38% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.60% | 96.09% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 97.99% | 90.08% |
| CHEMBL4644 | P41968 | Melanocortin receptor 3 | 97.84% | 99.52% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 97.78% | 90.20% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 97.57% | 92.12% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 97.54% | 91.81% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 97.47% | 96.31% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 97.06% | 97.14% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.97% | 97.09% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 96.78% | 88.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 96.37% | 95.89% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 96.05% | 91.19% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 95.84% | 82.38% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.66% | 99.17% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 95.49% | 92.97% |
| CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 95.27% | 96.67% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.21% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 95.11% | 99.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.90% | 94.45% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 94.48% | 83.82% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.05% | 95.56% |
| CHEMBL4608 | P33032 | Melanocortin receptor 5 | 93.96% | 97.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 93.91% | 93.10% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.77% | 89.00% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 92.63% | 95.83% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 92.33% | 100.00% |
| CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 92.08% | 96.03% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 91.34% | 98.33% |
| CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 91.00% | 98.24% |
| CHEMBL5939 | Q9NZ08 | Endoplasmic reticulum aminopeptidase 1 | 90.72% | 100.00% |
| CHEMBL2821 | P00748 | Coagulation factor XII | 90.44% | 96.21% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.19% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.15% | 93.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.99% | 98.75% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 89.47% | 83.10% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 89.32% | 96.11% |
| CHEMBL3024 | P53350 | Serine/threonine-protein kinase PLK1 | 89.27% | 97.43% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 88.34% | 100.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 86.98% | 96.47% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.90% | 95.50% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.40% | 82.69% |
| CHEMBL3392948 | Q9NP59 | Solute carrier family 40 member 1 | 85.38% | 95.00% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 84.11% | 92.32% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 83.21% | 94.66% |
| CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 83.14% | 82.86% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.80% | 90.17% |
| CHEMBL4895 | P30530 | Tyrosine-protein kinase receptor UFO | 82.66% | 90.95% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.58% | 95.71% |
| CHEMBL1921 | P47901 | Vasopressin V1b receptor | 82.27% | 92.50% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.22% | 99.15% |
| CHEMBL2803 | P43403 | Tyrosine-protein kinase ZAP-70 | 82.14% | 82.50% |
| CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 81.95% | 96.25% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.77% | 96.90% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.57% | 93.00% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.46% | 96.39% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.05% | 95.50% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.03% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162881497 |
| LOTUS | LTS0098059 |
| wikiData | Q104198189 |