3-oxo-3-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(E)-3-[3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(E)-3-[3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxymethyl]oxan-2-yl]oxyphenyl]prop-2-enoyl]oxymethyl]oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methoxy]propanoic acid
| Internal ID | faab3237-e07c-4721-83e3-264a9bdc7063 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
| IUPAC Name | 3-oxo-3-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[5-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(E)-3-[3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(E)-3-[3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxymethyl]oxan-2-yl]oxyphenyl]prop-2-enoyl]oxymethyl]oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromenylium-3-yl]oxyoxan-2-yl]methoxy]propanoic acid |
| SMILES (Canonical) | C1=CC(=C(C=C1C=CC(=O)OCC2C(C(C(C(O2)OC3=C(C=C(C=C3)C=CC(=O)OCC4C(C(C(C(O4)OC5=CC(=C6C=C(C(=[O+]C6=C5)C7=CC(=C(C(=C7)O)O)O)OC8C(C(C(C(O8)COC(=O)CC(=O)O)O)O)O)O)O)O)O)O)O)O)O)O)OC9C(C(C(C(O9)CO)O)O)O |
| SMILES (Isomeric) | C1=CC(=C(C=C1/C=C/C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(C=C(C=C3)/C=C/C(=O)OC[C@@H]4[C@H]([C@@H]([C@H]([C@@H](O4)OC5=CC(=C6C=C(C(=[O+]C6=C5)C7=CC(=C(C(=C7)O)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)COC(=O)CC(=O)O)O)O)O)O)O)O)O)O)O)O)O)O)O[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O |
| InChI | InChI=1S/C60H64O36/c61-17-35-44(73)48(77)53(82)58(93-35)90-31-5-1-21(9-27(31)63)4-8-41(70)86-19-37-46(75)50(79)54(83)59(95-37)91-32-6-2-22(10-28(32)64)3-7-40(69)85-18-36-45(74)49(78)52(81)57(94-36)88-24-13-26(62)25-15-34(56(89-33(25)14-24)23-11-29(65)43(72)30(66)12-23)92-60-55(84)51(80)47(76)38(96-60)20-87-42(71)16-39(67)68/h1-15,35-38,44-55,57-61,73-84H,16-20H2,(H6-,62,63,64,65,66,67,68,72)/p+1/b7-3+,8-4+/t35-,36-,37-,38-,44-,45-,46-,47-,48+,49+,50+,51+,52-,53-,54-,55-,57-,58-,59-,60-/m1/s1 |
| InChI Key | SOZRHWHFXBRBBE-BHKYSLMUSA-O |
| Popularity | 1 reference in papers |
| Molecular Formula | C60H65O36+ |
| Molecular Weight | 1362.10 g/mol |
| Exact Mass | 1361.3255534 g/mol |
| Topological Polar Surface Area (TPSA) | 575.00 Ų |
| XlogP | 0.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.58% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.09% | 91.49% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 97.91% | 96.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.90% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.62% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.38% | 99.17% |
| CHEMBL3194 | P02766 | Transthyretin | 94.30% | 90.71% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.24% | 99.15% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.95% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.80% | 97.09% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 88.08% | 83.00% |
| CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 86.60% | 95.83% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.98% | 95.56% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.52% | 95.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.15% | 95.89% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.52% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.52% | 94.73% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.92% | 94.33% |
| CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.61% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163183894 |
| LOTUS | LTS0207635 |
| wikiData | Q105257300 |