Lophocladine A
| Internal ID | 882a2707-a945-4598-bc57-75400e24cd5c |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Phenylpyridines |
| IUPAC Name | 4-phenyl-2H-2,7-naphthyridin-1-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H10N2O/c17-14-13-8-15-7-6-11(13)12(9-16-14)10-4-2-1-3-5-10/h1-9H,(H,16,17) |
| InChI Key | JIWHQPVTDQXELV-UHFFFAOYSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C14H10N2O |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.079312947 g/mol |
| Topological Polar Surface Area (TPSA) | 42.00 Ų |
| XlogP | 1.40 |
| 887705-27-3 |
| 2,7-Naphthyridin-1(2H)-one, 4-phenyl- |
| 2BWU9P2UEB |
| 4-Phenyl-2,7-naphthyridin-1(2H)-one |
| UNII-2BWU9P2UEB |
| 4-PHENYL-2H-2,7-NAPHTHYRIDIN-1-ONE |
| Lophocladines A |
| CHEMBL472895 |
| DTXSID90470935 |
| 4-phenyl[2,7]naphthyridin-1(2H)-one |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 95.34% | 93.24% |
| CHEMBL262 | P49841 | Glycogen synthase kinase-3 beta | 93.40% | 95.72% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.56% | 98.95% |
| CHEMBL5543 | Q9Y463 | Dual specificity tyrosine-phosphorylation-regulated kinase 1B | 90.42% | 94.70% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 90.00% | 92.67% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.24% | 99.23% |
| CHEMBL5443 | O00311 | Cell division cycle 7-related protein kinase | 88.94% | 96.11% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 88.42% | 96.47% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 87.76% | 94.62% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 86.73% | 98.59% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.76% | 90.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.87% | 95.56% |
| CHEMBL3231 | Q13464 | Rho-associated protein kinase 1 | 84.67% | 95.55% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.57% | 86.33% |
| CHEMBL202 | P00374 | Dihydrofolate reductase | 84.43% | 89.92% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.09% | 93.03% |
| CHEMBL2973 | O75116 | Rho-associated protein kinase 2 | 82.94% | 96.73% |
| CHEMBL2424504 | P29375 | Lysine-specific demethylase 5A | 82.30% | 99.23% |
| CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 81.98% | 83.00% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 81.44% | 91.38% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 80.79% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11708368 |
| LOTUS | LTS0069882 |
| wikiData | Q82299156 |