[(1S)-1-[4-[(2R,3R,4E,6E,8R,9R,10R,11E,13Z,15Z,17S,18R,19E,22E)-10,18-dihydroxy-8-methoxy-3,7,9,13,15,17,20-heptamethyl-24-oxo-1-oxacyclotetracosa-4,6,11,13,15,19,22-heptaen-2-yl]-1,3-thiazol-2-yl]-3-methylbutyl] N-methylcarbamate
| Internal ID | b56b22a7-f1b5-4235-bda2-b8553d4e6aea |
| Taxonomy | Phenylpropanoids and polyketides > Macrolides and analogues |
| IUPAC Name | [(1S)-1-[4-[(2R,3R,4E,6E,8R,9R,10R,11E,13Z,15Z,17S,18R,19E,22E)-10,18-dihydroxy-8-methoxy-3,7,9,13,15,17,20-heptamethyl-24-oxo-1-oxacyclotetracosa-4,6,11,13,15,19,22-heptaen-2-yl]-1,3-thiazol-2-yl]-3-methylbutyl] N-methylcarbamate |
| SMILES (Canonical) | CC1C=CC=C(C(C(C(C=CC(=CC(=CC(C(C=C(CC=CC(=O)OC1C2=CSC(=N2)C(CC(C)C)OC(=O)NC)C)O)C)C)C)O)C)OC)C |
| SMILES (Isomeric) | C[C@@H]1/C=C/C=C(/[C@@H]([C@@H]([C@@H](/C=C/C(=C\C(=C/[C@@H]([C@H](/C=C(/C/C=C/C(=O)O[C@H]1C2=CSC(=N2)[C@H](CC(C)C)OC(=O)NC)\C)O)C)\C)/C)O)C)OC)\C |
| InChI | InChI=1S/C41H60N2O7S/c1-25(2)20-36(49-41(47)42-10)40-43-33(24-51-40)39-30(7)16-13-15-29(6)38(48-11)32(9)34(44)19-18-27(4)21-28(5)22-31(8)35(45)23-26(3)14-12-17-37(46)50-39/h12-13,15-19,21-25,30-32,34-36,38-39,44-45H,14,20H2,1-11H3,(H,42,47)/b16-13+,17-12+,19-18+,26-23+,27-21-,28-22-,29-15+/t30-,31+,32-,34-,35+,36+,38+,39-/m1/s1 |
| InChI Key | BYVUBCIRZIXXCV-DPNHFVHGSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C41H60N2O7S |
| Molecular Weight | 725.00 g/mol |
| Exact Mass | 724.41212343 g/mol |
| Topological Polar Surface Area (TPSA) | 155.00 Ų |
| XlogP | 7.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL248 | P08246 | Leukocyte elastase |
316 nM |
IC50 |
via Super-PRED
|
| CHEMBL2998 | P56373 | P2X purinoceptor 3 |
353 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.33% | 83.82% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.26% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 96.50% | 99.23% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.19% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.90% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.67% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.86% | 95.56% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 89.42% | 97.53% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.52% | 86.33% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.48% | 90.71% |
| CHEMBL5028 | O14672 | ADAM10 | 86.21% | 97.50% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.88% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.20% | 99.17% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 84.13% | 97.33% |
| CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 83.84% | 95.71% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 83.14% | 91.07% |
| CHEMBL3891 | P07384 | Calpain 1 | 82.81% | 93.04% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.26% | 93.56% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 81.67% | 96.90% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.91% | 90.93% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.81% | 94.45% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.22% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163187573 |
| LOTUS | LTS0221387 |
| wikiData | Q104949957 |