(5S,6R)-N-[3-[2-amino-4-[(1R)-1-(2-amino-1H-imidazol-5-yl)-3-[[(5S,6R)-7,9-dibromo-6-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,7,9-triene-3-carbonyl]amino]propyl]-1H-imidazol-5-yl]propyl]-7,9-dibromo-6-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,7,9-triene-3-carboxamide
| Internal ID | dad0fe7c-7454-4e0d-95cf-3a285a859634 |
| Taxonomy | Organoheterocyclic compounds > Azolines > Isoxazolines |
| IUPAC Name | (5S,6R)-N-[3-[2-amino-4-[(1R)-1-(2-amino-1H-imidazol-5-yl)-3-[[(5S,6R)-7,9-dibromo-6-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,7,9-triene-3-carbonyl]amino]propyl]-1H-imidazol-5-yl]propyl]-7,9-dibromo-6-hydroxy-8-methoxy-1-oxa-2-azaspiro[4.5]deca-2,7,9-triene-3-carboxamide |
| SMILES (Canonical) | COC1=C(C(C2(CC(=NO2)C(=O)NCCCC3=C(N=C(N3)N)C(CCNC(=O)C4=NOC5(C4)C=C(C(=C(C5O)Br)OC)Br)C6=CN=C(N6)N)C=C1Br)O)Br |
| SMILES (Isomeric) | COC1=C([C@@H]([C@]2(CC(=NO2)C(=O)NCCCC3=C(N=C(N3)N)[C@H](CCNC(=O)C4=NO[C@@]5(C4)C=C(C(=C([C@@H]5O)Br)OC)Br)C6=CN=C(N6)N)C=C1Br)O)Br |
| InChI | InChI=1S/C32H36Br4N10O8/c1-51-23-14(33)8-31(25(47)20(23)35)10-17(45-53-31)27(49)39-6-3-4-16-22(44-30(38)42-16)13(19-12-41-29(37)43-19)5-7-40-28(50)18-11-32(54-46-18)9-15(34)24(52-2)21(36)26(32)48/h8-9,12-13,25-26,47-48H,3-7,10-11H2,1-2H3,(H,39,49)(H,40,50)(H3,37,41,43)(H3,38,42,44)/t13-,25+,26+,31-,32-/m1/s1 |
| InChI Key | OFFATAQJRNDHGP-NTPYOUGBSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C32H36Br4N10O8 |
| Molecular Weight | 1008.30 g/mol |
| Exact Mass | 1007.94101 g/mol |
| Topological Polar Surface Area (TPSA) | 270.00 Ų |
| XlogP | 0.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.51% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.82% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.37% | 94.45% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 95.09% | 94.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.37% | 90.17% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.30% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.37% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 91.40% | 89.63% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 90.89% | 100.00% |
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV | 89.89% | 95.69% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 89.78% | 95.17% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.42% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.37% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.01% | 97.09% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 86.82% | 94.73% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.79% | 90.71% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 85.04% | 89.67% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.91% | 92.88% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 84.25% | 92.29% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.99% | 96.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 83.94% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.62% | 95.56% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 82.60% | 96.90% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.08% | 86.33% |
| CHEMBL5028 | O14672 | ADAM10 | 81.85% | 97.50% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 81.63% | 93.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163005664 |
| LOTUS | LTS0104216 |
| wikiData | Q104665537 |