1-hydroxy-3-methyl-2-[(E)-non-2-enyl]quinolin-4-one
| Internal ID | 20481d02-945c-4d69-b415-af8ddfb18ec0 |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Hydroquinolones |
| IUPAC Name | 1-hydroxy-3-methyl-2-[(E)-non-2-enyl]quinolin-4-one |
| SMILES (Canonical) | CCCCCCC=CCC1=C(C(=O)C2=CC=CC=C2N1O)C |
| SMILES (Isomeric) | CCCCCC/C=C/CC1=C(C(=O)C2=CC=CC=C2N1O)C |
| InChI | InChI=1S/C19H25NO2/c1-3-4-5-6-7-8-9-13-17-15(2)19(21)16-12-10-11-14-18(16)20(17)22/h8-12,14,22H,3-7,13H2,1-2H3/b9-8+ |
| InChI Key | HMCYNESTDVUAKN-CMDGGOBGSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.188529040 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 5.50 |
| YM 30059 |
| RefChem:934429 |
| 1-hydroxy-3-methyl-2-[(E)-non-2-enyl]quinolin-4-one |
| SCHEMBL2870551 |
| CHEMBL4752770 |
| CHEBI:204529 |
| 162382-62-9 |
![2D Structure of 1-hydroxy-3-methyl-2-[(E)-non-2-enyl]quinolin-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/1-hydroxy-3-methyl-2-e-non-2-enylquinolin-4-one.jpg "2D Structure of 1-hydroxy-3-methyl-2-[(E)-non-2-enyl]quinolin-4-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.80% | 98.95% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 97.42% | 85.94% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.37% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 96.17% | 93.99% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 94.76% | 92.08% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.04% | 99.17% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 88.90% | 97.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.12% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.99% | 94.73% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 87.87% | 91.81% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.98% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.48% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.07% | 99.23% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 83.72% | 90.08% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.11% | 86.33% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 82.93% | 89.63% |
| CHEMBL1868 | P17948 | Vascular endothelial growth factor receptor 1 | 82.32% | 96.47% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.16% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 9851626 |
| LOTUS | LTS0122939 |
| wikiData | Q77386422 |