N-(3-amino-3-oxoprop-1-en-2-yl)-2-[30-(4,5-dihydroxy-4,6-dimethyloxan-2-yl)oxy-9,52-dihydroxy-18-(1-hydroxyethyl)-21-(1-methoxyethylidene)-16,19,26,31,42,46-hexaoxo-32,43,54-trioxa-3,13,23,49-tetrathia-7,17,20,27,45,51,52,55,56,57-decazadecacyclo[26.16.6.229,40.12,5.112,15.122,25.138,41.147,50.06,11.034,39]heptapentaconta-2(57),4,6,8,10,12(56),14,22(55),24,34(39),35,37,40,47,50-pentadecaen-8-yl]-1,3-thiazole-4-carboxamide
| Internal ID | 688c71e7-5328-4180-b69f-9c75b1e363f7 |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolecarboxylic acids and derivatives |
| IUPAC Name | N-(3-amino-3-oxoprop-1-en-2-yl)-2-[30-(4,5-dihydroxy-4,6-dimethyloxan-2-yl)oxy-9,52-dihydroxy-18-(1-hydroxyethyl)-21-(1-methoxyethylidene)-16,19,26,31,42,46-hexaoxo-32,43,54-trioxa-3,13,23,49-tetrathia-7,17,20,27,45,51,52,55,56,57-decazadecacyclo[26.16.6.229,40.12,5.112,15.122,25.138,41.147,50.06,11.034,39]heptapentaconta-2(57),4,6,8,10,12(56),14,22(55),24,34(39),35,37,40,47,50-pentadecaen-8-yl]-1,3-thiazole-4-carboxamide |
| SMILES (Canonical) | CC1C(C(CC(O1)OC2C3C4C5=NC(=CS5)C(=O)NC(COC(=O)C6=C(CO3)C7=C(COC2=O)C=CC=C7N6O)C8=NC(=CS8)C9=NC(=C(C=C9C1=NC(=CS1)C(=O)NC(C(=O)NC(=C(C)OC)C1=NC(=CS1)C(=O)N4)C(C)O)O)C1=NC(=CS1)C(=O)NC(=C)C(=O)N)(C)O)O |
| SMILES (Isomeric) | CC1C(C(CC(O1)OC2C3C4C5=NC(=CS5)C(=O)NC(COC(=O)C6=C(CO3)C7=C(COC2=O)C=CC=C7N6O)C8=NC(=CS8)C9=NC(=C(C=C9C1=NC(=CS1)C(=O)NC(C(=O)NC(=C(C)OC)C1=NC(=CS1)C(=O)N4)C(C)O)O)C1=NC(=CS1)C(=O)NC(=C)C(=O)N)(C)O)O |
| InChI | InChI=1S/C59H55N13O19S5/c1-20(46(60)76)61-47(77)29-17-95-55(66-29)40-34(74)10-25-39(68-40)28-15-93-53(63-28)27-14-89-57(82)42-26-13-87-43(44(91-35-11-59(5,84)45(75)23(4)90-35)58(83)88-12-24-8-7-9-33(36(24)26)72(42)85)41(56-67-30(18-96-56)48(78)62-27)71-50(80)32-19-94-54(65-32)38(22(3)86-6)70-51(81)37(21(2)73)69-49(79)31-16-92-52(25)64-31/h7-10,15-19,21,23,27,35,37,41,43-45,73-75,84-85H,1,11-14H2,2-6H3,(H2,60,76)(H,61,77)(H,62,78)(H,69,79)(H,70,81)(H,71,80) |
| InChI Key | UZZVXLOCAWZSCJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C59H55N13O19S5 |
| Molecular Weight | 1410.50 g/mol |
| Exact Mass | 1409.23407244 g/mol |
| Topological Polar Surface Area (TPSA) | 603.00 Ų |
| XlogP | 2.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.37% | 96.09% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 99.28% | 93.03% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.25% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 98.99% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.20% | 86.33% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 98.14% | 99.23% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.96% | 94.45% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.46% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.22% | 89.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.06% | 85.14% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 96.04% | 83.10% |
| CHEMBL2243 | O00519 | Anandamide amidohydrolase | 95.79% | 97.53% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 94.65% | 80.96% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 94.64% | 95.56% |
| CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 94.20% | 91.24% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 94.16% | 80.71% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.01% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.45% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.49% | 99.15% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.04% | 96.77% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.67% | 96.21% |
| CHEMBL3038469 | P24941 | CDK2/Cyclin A | 91.48% | 91.38% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 91.04% | 91.19% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 90.53% | 93.10% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 89.33% | 95.58% |
| CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 88.92% | 95.64% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.92% | 97.09% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 87.60% | 95.17% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.38% | 100.00% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 86.64% | 92.88% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 86.50% | 85.11% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.45% | 92.62% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.93% | 90.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 84.71% | 94.73% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.42% | 97.14% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 84.18% | 96.67% |
| CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 84.13% | 94.05% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.90% | 98.75% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.30% | 90.71% |
| CHEMBL4531 | P17931 | Galectin-3 | 80.73% | 96.90% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.54% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 22835609 |
| LOTUS | LTS0081493 |
| wikiData | Q104199135 |