(-)-tersone B
| Internal ID | dcfb6082-3ffd-4729-92f6-1febb11859dc |
| Taxonomy | Organoheterocyclic compounds > Pyridines and derivatives > Phenylpyridines |
| IUPAC Name | (2S,3R,6S)-4-(hydroxymethyl)-3,6-dimethyl-9-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(8),4,9-trien-12-one |
| SMILES (Canonical) | CC1C2C3=C(C(=CNC3=O)C4=CC=CC=C4)OC2(C=C1CO)C |
| SMILES (Isomeric) | C[C@@H]1[C@H]2C3=C(C(=CNC3=O)C4=CC=CC=C4)O[C@]2(C=C1CO)C |
| InChI | InChI=1S/C19H19NO3/c1-11-13(10-21)8-19(2)16(11)15-17(23-19)14(9-20-18(15)22)12-6-4-3-5-7-12/h3-9,11,16,21H,10H2,1-2H3,(H,20,22)/t11-,16-,19-/m0/s1 |
| InChI Key | QVWZGMSQOPIXBC-UTLVKMTRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13649347 g/mol |
| Topological Polar Surface Area (TPSA) | 58.60 Ų |
| XlogP | 0.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.27% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.78% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.54% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.72% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.91% | 86.33% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 90.91% | 91.71% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.88% | 99.23% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.49% | 89.00% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 84.28% | 89.44% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 83.54% | 91.49% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.14% | 95.93% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 80.52% | 90.17% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.22% | 93.03% |
| CHEMBL5028 | O14672 | ADAM10 | 80.03% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 146683006 |
| LOTUS | LTS0108619 |
| wikiData | Q105228976 |